![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Human Sex Cells and Systems.pdf | 2022-03-16 10:31 | 1.9M | |
![[ ]](/icons/layout.gif) | Hydraulics.pdf | 2022-03-16 10:32 | 1.0M | |
![[ ]](/icons/layout.gif) | Hurricanes.pdf | 2022-03-16 10:32 | 1.6M | |
![[ ]](/icons/layout.gif) | Igneous Rocks.pdf | 2022-03-16 10:34 | 1.2M | |
![[ ]](/icons/layout.gif) | Inheritance.pdf | 2022-03-16 10:35 | 1.9M | |
![[ ]](/icons/layout.gif) | Leaves and Glucose.pdf | 2022-03-16 10:35 | 1.9M | |
![[ ]](/icons/layout.gif) | Looking at Cells.pdf | 2022-03-16 10:35 | 1.9M | |
![[ ]](/icons/layout.gif) | Magnetic Fields.pdf | 2022-03-16 10:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Making Compounds.pdf | 2022-03-16 10:36 | 456K | |
![[ ]](/icons/layout.gif) | Making Gases.pdf | 2022-03-16 10:36 | 1.8M | |
![[ ]](/icons/layout.gif) | Metalloids.pdf | 2022-03-16 10:36 | 469K | |
![[ ]](/icons/layout.gif) | Metals and Nonmetals.pdf | 2022-03-16 10:36 | 1.6M | |
![[ ]](/icons/layout.gif) | Metamorphic Rocks.pdf | 2022-03-16 10:37 | 1.0M | |
![[ ]](/icons/layout.gif) | Moment Calculations.pdf | 2022-03-16 10:37 | 656K | |
![[ ]](/icons/layout.gif) | Moments.pdf | 2022-03-16 10:37 | 205K | |
![[ ]](/icons/layout.gif) | Naming Compounds.pdf | 2022-03-16 10:38 | 466K | |
![[ ]](/icons/layout.gif) | Neutralization.pdf | 2022-03-16 10:38 | 1.6M | |
![[ ]](/icons/layout.gif) | Nonrenewable Energy Resources.pdf | 2022-03-16 10:38 | 1.4M | |
![[ ]](/icons/layout.gif) | Parallel Circuits.pdf | 2022-03-16 10:39 | 966K | |
![[ ]](/icons/layout.gif) | Particles in Action.pdf | 2022-03-16 10:39 | 1.6M | |
![[ ]](/icons/layout.gif) | Physical Weathering.pdf | 2022-03-16 10:40 | 808K | |
![[ ]](/icons/layout.gif) | Plants as Food.pdf | 2022-03-16 10:40 | 390K | |
![[ ]](/icons/layout.gif) | Plate Boundaries.pdf | 2022-03-16 10:40 | 4.0M | |
![[ ]](/icons/layout.gif) | Precipitation.pdf | 2022-03-16 10:41 | 2.1M | |
![[ ]](/icons/layout.gif) | Puberty.pdf | 2022-03-16 10:41 | 941K | |
![[ ]](/icons/layout.gif) | Pyramids of Numbers and Biomass.pdf | 2022-03-16 10:43 | 1.2M | |
![[ ]](/icons/layout.gif) | Radiation.pdf | 2022-03-16 10:43 | 263K | |
![[ ]](/icons/layout.gif) | Recycling Nutrients.pdf | 2022-03-16 10:43 | 779K | |
![[ ]](/icons/layout.gif) | Reducing Our Energy Bills.pdf | 2022-03-16 10:44 | 229K | |
![[ ]](/icons/layout.gif) | Reflection.pdf | 2022-03-16 10:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Refraction.pdf | 2022-03-16 10:44 | 1.4M | |
![[ ]](/icons/layout.gif) | Releasing Energy.pdf | 2022-03-16 10:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Renewable Energy.pdf | 2022-03-16 10:45 | 1.2M | |
![[ ]](/icons/layout.gif) | Respiration and the Circulatory System.pdf | 2022-03-16 10:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Roots and Water.pdf | 2022-03-16 10:45 | 269K | |
![[ ]](/icons/layout.gif) | Satellites.pdf | 2022-03-16 10:46 | 1.2M | |
![[ ]](/icons/layout.gif) | Sedimentary Rocks.pdf | 2022-03-16 10:46 | 1.4M | |
![[ ]](/icons/layout.gif) | Selecting Characteristics.pdf | 2022-03-16 10:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Separating Mixtures.pdf | 2022-03-16 10:46 | 1.8M | |
![[ ]](/icons/layout.gif) | Series Circuits.pdf | 2022-03-16 10:48 | 1.8M | |
![[ ]](/icons/layout.gif) | Soil.pdf | 2022-03-16 10:48 | 1.3M | |
![[ ]](/icons/layout.gif) | Solutions.pdf | 2022-03-16 10:49 | 1.5M | |
![[ ]](/icons/layout.gif) | Speed of Sound.pdf | 2022-03-16 10:49 | 1.0M | |
![[ ]](/icons/layout.gif) | Symbols for Elements.pdf | 2022-03-16 10:49 | 497K | |
![[ ]](/icons/layout.gif) | The Atmosphere.pdf | 2022-03-16 10:50 | 386K | |
![[ ]](/icons/layout.gif) | The Ear and Hearing.pdf | 2022-03-16 10:50 | 1.9M | |
![[ ]](/icons/layout.gif) | The Earth Moon and Sun.pdf | 2022-03-16 10:50 | 1.4M | |
![[ ]](/icons/layout.gif) | The Endocrine System.pdf | 2022-03-16 10:50 | 647K | |
![[ ]](/icons/layout.gif) | The Musculoskeletal System.pdf | 2022-03-16 10:51 | 1.3M | |
![[ ]](/icons/layout.gif) | The Nervous System.pdf | 2022-03-16 10:52 | 1.7M | |
![[ ]](/icons/layout.gif) | The Periodic Table.pdf | 2022-03-16 10:53 | 1.0M | |
![[ ]](/icons/layout.gif) | The pH Scale.pdf | 2022-03-16 10:53 | 1.6M | |
![[ ]](/icons/layout.gif) | The Respiratory System.pdf | 2022-03-16 10:53 | 1.3M | |
![[ ]](/icons/layout.gif) | The Rock Cycle.pdf | 2022-03-16 10:53 | 1.6M | |
![[ ]](/icons/layout.gif) | The Solar System.pdf | 2022-03-16 10:54 | 1.8M | |
![[ ]](/icons/layout.gif) | The Structure of the Earth.pdf | 2022-03-16 10:54 | 1.2M | |
![[ ]](/icons/layout.gif) | The Water Cycle.pdf | 2022-03-16 10:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Tornados.pdf | 2022-03-16 10:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Tsunami Case Study.pdf | 2022-03-16 10:56 | 815K | |
![[ ]](/icons/layout.gif) | Types of Animal Behavior.pdf | 2022-03-16 10:57 | 1.2M | |
![[ ]](/icons/layout.gif) | Types of Chemical Reactions.pdf | 2022-03-16 10:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Types of Reproduction.pdf | 2022-03-16 11:00 | 591K | |
![[ ]](/icons/layout.gif) | Types of Variation.pdf | 2022-03-16 11:00 | 1.3M | |
![[ ]](/icons/layout.gif) | Uses of Electromagnets.pdf | 2022-03-16 11:00 | 1.2M | |
![[ ]](/icons/layout.gif) | Uses of Microbes.pdf | 2022-03-16 11:01 | 471K | |
![[ ]](/icons/layout.gif) | Using Rocks.pdf | 2022-03-16 11:01 | 1.2M | |
![[ ]](/icons/layout.gif) | Weather Hazards.pdf | 2022-03-16 11:02 | 2.4M | |
![[ ]](/icons/layout.gif) | What Are Acids and Alkalis.pdf | 2022-03-16 11:02 | 677K | |
![[ ]](/icons/layout.gif) | What Are Atoms.pdf | 2022-03-16 11:02 | 1.1M | |
![[ ]](/icons/layout.gif) | What Are Circuits.pdf | 2022-03-16 11:03 | 1.1M | |
![[ ]](/icons/layout.gif) | What Are Forces.pdf | 2022-03-16 11:03 | 1.3M | |
![[ ]](/icons/layout.gif) | What Are Indicators.pdf | 2022-03-16 11:03 | 796K | |
![[ ]](/icons/layout.gif) | What Are Microbes.pdf | 2022-03-16 11:04 | 898K | |
![[ ]](/icons/layout.gif) | What is a Mixture.pdf | 2022-03-16 11:04 | 652K | |
![[ ]](/icons/layout.gif) | What is Energy.pdf | 2022-03-16 11:04 | 1.0M | |
![[ ]](/icons/layout.gif) | What is Light.pdf | 2022-03-16 11:04 | 811K | |
![[ ]](/icons/layout.gif) | What is Photosynthesis.pdf | 2022-03-16 11:05 | 745K | |
![[ ]](/icons/layout.gif) | What is Plate Tectonics.pdf | 2022-03-16 11:05 | 1.2M | |
![[ ]](/icons/layout.gif) | What is Sound.pdf | 2022-03-16 11:05 | 1.4M | |
![[ ]](/icons/layout.gif) | What is Weather.pdf | 2022-03-16 11:06 | 3.1M | |
![[ ]](/icons/layout.gif) | Where Do Cells Come From.pdf | 2022-03-16 11:06 | 454K | |
![[ ]](/icons/layout.gif) | Wind and Ocean Currents.pdf | 2022-03-16 11:06 | 1.3M | |
![[ ]](/icons/layout.gif) | Acid Rain.pdf | 2022-03-16 11:42 | 652K | |
![[ ]](/icons/layout.gif) | Biological Weathering.pdf | 2022-03-16 11:43 | 869K | |
![[ ]](/icons/layout.gif) | Chemical Weathering.pdf | 2022-03-16 11:44 | 670K | |
![[ ]](/icons/layout.gif) | Chemical Digestion.pdf | 2022-03-16 11:44 | 804K | |
![[ ]](/icons/layout.gif) | Animal and Plant Cells.pdf | 2022-03-16 11:48 | 1.5M | |
![[ ]](/icons/layout.gif) | Adaptations.pdf | 2022-03-16 11:48 | 670K | |
![[ ]](/icons/layout.gif) | Animal Behavior.pdf | 2022-03-16 11:49 | 508K | |
![[ ]](/icons/layout.gif) | Atomic Structure.pdf | 2022-03-16 11:49 | 1.1M | |
![[ ]](/icons/layout.gif) | Average and Instantaneous Speed.pdf | 2022-03-16 11:49 | 546K | |
![[ ]](/icons/layout.gif) | Balancing Equations.pdf | 2022-03-16 11:50 | 223K | |
![[ ]](/icons/layout.gif) | Causes of Variation.pdf | 2022-03-16 11:51 | 1.7M | |
![[ ]](/icons/layout.gif) | Cells to Organisms.pdf | 2022-03-16 11:51 | 1.1M | |
![[ ]](/icons/layout.gif) | Changes of Matter.pdf | 2022-03-16 11:52 | 884K | |
![[ ]](/icons/layout.gif) | Changing State.pdf | 2022-03-16 11:52 | 879K | |
![[ ]](/icons/layout.gif) | Chromatography.pdf | 2022-03-16 11:52 | 891K | |
![[ ]](/icons/layout.gif) | Classifying Organisms.pdf | 2022-03-16 11:53 | 655K | |
![[ ]](/icons/layout.gif) | Climate Zones.pdf | 2022-03-16 11:53 | 1.8M | |
![[ ]](/icons/layout.gif) | Color.pdf | 2022-03-16 11:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Competition.pdf | 2022-03-16 11:54 | 692K | |
![[ ]](/icons/layout.gif) | Conduction and Convection.pdf | 2022-03-16 11:54 | 1.7M | |
![[ ]](/icons/layout.gif) | Conservation of Mass.pdf | 2022-03-16 11:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Days Years and Seasons.pdf | 2022-03-16 12:48 | 609K | |
![[ ]](/icons/layout.gif) | Different Types of Rocks.pdf | 2022-03-16 12:49 | 834K | |
![[ ]](/icons/layout.gif) | Digestion.pdf | 2022-03-16 12:49 | 1.3M | |
![[ ]](/icons/layout.gif) | Distance Time and Speed.pdf | 2022-03-16 12:49 | 1.0M | |
![[ ]](/icons/layout.gif) | Earthquakes.pdf | 2022-03-16 12:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Electromagnets.pdf | 2022-03-16 12:50 | 802K | |
![[ ]](/icons/layout.gif) | Elements and Compounds.pdf | 2022-03-16 12:50 | 1.6M | |
![[ ]](/icons/layout.gif) | Embryo Development and Birth.pdf | 2022-03-16 12:51 | 1.6M | |
![[ ]](/icons/layout.gif) | Energy Changes.pdf | 2022-03-16 12:51 | 1.3M | |
![[ ]](/icons/layout.gif) | Energy Efficiency.pdf | 2022-03-16 12:51 | 787K | |
![[ ]](/icons/layout.gif) | Energy Resources for the Future.pdf | 2022-03-16 12:52 | 877K | |
![[ ]](/icons/layout.gif) | Energy Transfer in Circuits.pdf | 2022-03-16 12:52 | 367K | |
![[ ]](/icons/layout.gif) | Environmental Change.pdf | 2022-03-16 12:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Gravity.pdf | 2022-03-16 12:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Gregor Mendel.pdf | 2022-03-16 12:55 | 1.2M | |
![[ ]](/icons/layout.gif) | Growing Plants.pdf | 2022-03-16 12:55 | 876K | |
![[ ]](/icons/layout.gif) | Human Behavior.pdf | 2022-03-16 12:55 | 699K | |
![[ ]](/icons/layout.gif) | Evolution.pdf | 2022-03-16 13:04 | 2.0M | |
![[ ]](/icons/layout.gif) | How Microbes Cause Disease.pdf | 2022-03-16 13:05 | 262K | |
![[ ]](/icons/layout.gif) | Heat and Temperature.pdf | 2022-03-16 13:06 | 473K | |
![[ ]](/icons/layout.gif) | Habitats.pdf | 2022-03-16 13:06 | 1.3M | |
![[ ]](/icons/layout.gif) | Greenhouse Gases.pdf | 2022-03-16 13:06 | 701K | |
![[ ]](/icons/layout.gif) | Graphing Speed.pdf | 2022-03-16 13:07 | 517K | |
![[ ]](/icons/layout.gif) | Genes and Alleles.pdf | 2022-03-16 13:07 | 718K | |
![[ ]](/icons/layout.gif) | Friction.pdf | 2022-03-16 13:07 | 1.7M | |
![[ ]](/icons/layout.gif) | Exploring Space.pdf | 2022-03-16 13:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Calculating Resultant Forces.pdf | 2022-03-16 13:18 | 413K | |
![[ ]](/icons/layout.gif) | Electromagnetic Waves.pdf | 2022-03-16 13:18 | 1.2M | |
![[ ]](/icons/layout.gif) | Erosion Transportation and Deposition.pdf | 2022-03-16 13:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Everyday Chemical Reactions.pdf | 2022-03-16 13:19 | 943K | |
![[ ]](/icons/layout.gif) | Feeding Types.pdf | 2022-03-16 13:19 | 780K | |
![[ ]](/icons/layout.gif) | Food Chains.pdf | 2022-03-16 13:19 | 1.2M | |
![[ ]](/icons/layout.gif) | Food Webs.pdf | 2022-03-16 13:20 | 748K | |
![[ ]](/icons/layout.gif) | Formulae of Compounds.pdf | 2022-03-16 13:20 | 519K | |
![[ ]](/icons/layout.gif) | Fossil Fuels.pdf | 2022-03-16 13:20 | 1.4M | |
![[ ]](/icons/layout.gif) | Fighting Disease.pdf | 2022-03-16 13:21 | 1.2M | |
![[ ]](/icons/layout.gif) | Flooding.pdf | 2022-03-16 13:21 | 623K | |
![[ ]](/icons/layout.gif) | How is Electrical Energy Useful.pdf | 2022-03-16 13:27 | 629K | |
|