![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Human Sex Cells and Systems.pdf | 2022-03-16 10:31 | 1.9M | |
| Hydraulics.pdf | 2022-03-16 10:32 | 1.0M | |
| Hurricanes.pdf | 2022-03-16 10:32 | 1.6M | |
| Igneous Rocks.pdf | 2022-03-16 10:34 | 1.2M | |
| Inheritance.pdf | 2022-03-16 10:35 | 1.9M | |
| Leaves and Glucose.pdf | 2022-03-16 10:35 | 1.9M | |
| Looking at Cells.pdf | 2022-03-16 10:35 | 1.9M | |
| Magnetic Fields.pdf | 2022-03-16 10:35 | 1.4M | |
| Making Compounds.pdf | 2022-03-16 10:36 | 456K | |
| Making Gases.pdf | 2022-03-16 10:36 | 1.8M | |
| Metalloids.pdf | 2022-03-16 10:36 | 469K | |
| Metals and Nonmetals.pdf | 2022-03-16 10:36 | 1.6M | |
| Metamorphic Rocks.pdf | 2022-03-16 10:37 | 1.0M | |
| Moment Calculations.pdf | 2022-03-16 10:37 | 656K | |
| Moments.pdf | 2022-03-16 10:37 | 205K | |
| Naming Compounds.pdf | 2022-03-16 10:38 | 466K | |
| Neutralization.pdf | 2022-03-16 10:38 | 1.6M | |
| Nonrenewable Energy Resources.pdf | 2022-03-16 10:38 | 1.4M | |
| Parallel Circuits.pdf | 2022-03-16 10:39 | 966K | |
| Particles in Action.pdf | 2022-03-16 10:39 | 1.6M | |
| Physical Weathering.pdf | 2022-03-16 10:40 | 808K | |
| Plants as Food.pdf | 2022-03-16 10:40 | 390K | |
| Plate Boundaries.pdf | 2022-03-16 10:40 | 4.0M | |
| Precipitation.pdf | 2022-03-16 10:41 | 2.1M | |
| Puberty.pdf | 2022-03-16 10:41 | 941K | |
| Pyramids of Numbers and Biomass.pdf | 2022-03-16 10:43 | 1.2M | |
| Radiation.pdf | 2022-03-16 10:43 | 263K | |
| Recycling Nutrients.pdf | 2022-03-16 10:43 | 779K | |
| Reducing Our Energy Bills.pdf | 2022-03-16 10:44 | 229K | |
| Reflection.pdf | 2022-03-16 10:44 | 1.0M | |
| Refraction.pdf | 2022-03-16 10:44 | 1.4M | |
| Releasing Energy.pdf | 2022-03-16 10:45 | 1.0M | |
| Renewable Energy.pdf | 2022-03-16 10:45 | 1.2M | |
| Respiration and the Circulatory System.pdf | 2022-03-16 10:45 | 1.0M | |
| Roots and Water.pdf | 2022-03-16 10:45 | 269K | |
| Satellites.pdf | 2022-03-16 10:46 | 1.2M | |
| Sedimentary Rocks.pdf | 2022-03-16 10:46 | 1.4M | |
| Selecting Characteristics.pdf | 2022-03-16 10:46 | 1.0M | |
| Separating Mixtures.pdf | 2022-03-16 10:46 | 1.8M | |
| Series Circuits.pdf | 2022-03-16 10:48 | 1.8M | |
| Soil.pdf | 2022-03-16 10:48 | 1.3M | |
| Solutions.pdf | 2022-03-16 10:49 | 1.5M | |
| Speed of Sound.pdf | 2022-03-16 10:49 | 1.0M | |
| Symbols for Elements.pdf | 2022-03-16 10:49 | 497K | |
| The Atmosphere.pdf | 2022-03-16 10:50 | 386K | |
| The Ear and Hearing.pdf | 2022-03-16 10:50 | 1.9M | |
| The Earth Moon and Sun.pdf | 2022-03-16 10:50 | 1.4M | |
| The Endocrine System.pdf | 2022-03-16 10:50 | 647K | |
| The Musculoskeletal System.pdf | 2022-03-16 10:51 | 1.3M | |
| The Nervous System.pdf | 2022-03-16 10:52 | 1.7M | |
| The Periodic Table.pdf | 2022-03-16 10:53 | 1.0M | |
| The pH Scale.pdf | 2022-03-16 10:53 | 1.6M | |
| The Respiratory System.pdf | 2022-03-16 10:53 | 1.3M | |
| The Rock Cycle.pdf | 2022-03-16 10:53 | 1.6M | |
| The Solar System.pdf | 2022-03-16 10:54 | 1.8M | |
| The Structure of the Earth.pdf | 2022-03-16 10:54 | 1.2M | |
| The Water Cycle.pdf | 2022-03-16 10:55 | 1.1M | |
| Tornados.pdf | 2022-03-16 10:55 | 1.0M | |
| Tsunami Case Study.pdf | 2022-03-16 10:56 | 815K | |
| Types of Animal Behavior.pdf | 2022-03-16 10:57 | 1.2M | |
| Types of Chemical Reactions.pdf | 2022-03-16 10:59 | 1.1M | |
| Types of Reproduction.pdf | 2022-03-16 11:00 | 591K | |
| Types of Variation.pdf | 2022-03-16 11:00 | 1.3M | |
| Uses of Electromagnets.pdf | 2022-03-16 11:00 | 1.2M | |
| Uses of Microbes.pdf | 2022-03-16 11:01 | 471K | |
| Using Rocks.pdf | 2022-03-16 11:01 | 1.2M | |
| Weather Hazards.pdf | 2022-03-16 11:02 | 2.4M | |
| What Are Acids and Alkalis.pdf | 2022-03-16 11:02 | 677K | |
| What Are Atoms.pdf | 2022-03-16 11:02 | 1.1M | |
| What Are Circuits.pdf | 2022-03-16 11:03 | 1.1M | |
| What Are Forces.pdf | 2022-03-16 11:03 | 1.3M | |
| What Are Indicators.pdf | 2022-03-16 11:03 | 796K | |
| What Are Microbes.pdf | 2022-03-16 11:04 | 898K | |
| What is a Mixture.pdf | 2022-03-16 11:04 | 652K | |
| What is Energy.pdf | 2022-03-16 11:04 | 1.0M | |
| What is Light.pdf | 2022-03-16 11:04 | 811K | |
| What is Photosynthesis.pdf | 2022-03-16 11:05 | 745K | |
| What is Plate Tectonics.pdf | 2022-03-16 11:05 | 1.2M | |
| What is Sound.pdf | 2022-03-16 11:05 | 1.4M | |
| What is Weather.pdf | 2022-03-16 11:06 | 3.1M | |
| Where Do Cells Come From.pdf | 2022-03-16 11:06 | 454K | |
| Wind and Ocean Currents.pdf | 2022-03-16 11:06 | 1.3M | |
| Acid Rain.pdf | 2022-03-16 11:42 | 652K | |
| Biological Weathering.pdf | 2022-03-16 11:43 | 869K | |
| Chemical Weathering.pdf | 2022-03-16 11:44 | 670K | |
| Chemical Digestion.pdf | 2022-03-16 11:44 | 804K | |
| Animal and Plant Cells.pdf | 2022-03-16 11:48 | 1.5M | |
| Adaptations.pdf | 2022-03-16 11:48 | 670K | |
| Animal Behavior.pdf | 2022-03-16 11:49 | 508K | |
| Atomic Structure.pdf | 2022-03-16 11:49 | 1.1M | |
| Average and Instantaneous Speed.pdf | 2022-03-16 11:49 | 546K | |
| Balancing Equations.pdf | 2022-03-16 11:50 | 223K | |
| Causes of Variation.pdf | 2022-03-16 11:51 | 1.7M | |
| Cells to Organisms.pdf | 2022-03-16 11:51 | 1.1M | |
| Changes of Matter.pdf | 2022-03-16 11:52 | 884K | |
| Changing State.pdf | 2022-03-16 11:52 | 879K | |
| Chromatography.pdf | 2022-03-16 11:52 | 891K | |
| Classifying Organisms.pdf | 2022-03-16 11:53 | 655K | |
| Climate Zones.pdf | 2022-03-16 11:53 | 1.8M | |
| Color.pdf | 2022-03-16 11:54 | 1.1M | |
| Competition.pdf | 2022-03-16 11:54 | 692K | |
| Conduction and Convection.pdf | 2022-03-16 11:54 | 1.7M | |
| Conservation of Mass.pdf | 2022-03-16 11:55 | 1.0M | |
| Days Years and Seasons.pdf | 2022-03-16 12:48 | 609K | |
| Different Types of Rocks.pdf | 2022-03-16 12:49 | 834K | |
| Digestion.pdf | 2022-03-16 12:49 | 1.3M | |
| Distance Time and Speed.pdf | 2022-03-16 12:49 | 1.0M | |
| Earthquakes.pdf | 2022-03-16 12:50 | 1.9M | |
| Electromagnets.pdf | 2022-03-16 12:50 | 802K | |
| Elements and Compounds.pdf | 2022-03-16 12:50 | 1.6M | |
| Embryo Development and Birth.pdf | 2022-03-16 12:51 | 1.6M | |
| Energy Changes.pdf | 2022-03-16 12:51 | 1.3M | |
| Energy Efficiency.pdf | 2022-03-16 12:51 | 787K | |
| Energy Resources for the Future.pdf | 2022-03-16 12:52 | 877K | |
| Energy Transfer in Circuits.pdf | 2022-03-16 12:52 | 367K | |
| Environmental Change.pdf | 2022-03-16 12:53 | 1.1M | |
| Gravity.pdf | 2022-03-16 12:54 | 1.6M | |
| Gregor Mendel.pdf | 2022-03-16 12:55 | 1.2M | |
| Growing Plants.pdf | 2022-03-16 12:55 | 876K | |
| Human Behavior.pdf | 2022-03-16 12:55 | 699K | |
| Evolution.pdf | 2022-03-16 13:04 | 2.0M | |
| How Microbes Cause Disease.pdf | 2022-03-16 13:05 | 262K | |
| Heat and Temperature.pdf | 2022-03-16 13:06 | 473K | |
| Habitats.pdf | 2022-03-16 13:06 | 1.3M | |
| Greenhouse Gases.pdf | 2022-03-16 13:06 | 701K | |
| Graphing Speed.pdf | 2022-03-16 13:07 | 517K | |
| Genes and Alleles.pdf | 2022-03-16 13:07 | 718K | |
| Friction.pdf | 2022-03-16 13:07 | 1.7M | |
| Exploring Space.pdf | 2022-03-16 13:08 | 1.1M | |
| Calculating Resultant Forces.pdf | 2022-03-16 13:18 | 413K | |
| Electromagnetic Waves.pdf | 2022-03-16 13:18 | 1.2M | |
| Erosion Transportation and Deposition.pdf | 2022-03-16 13:18 | 1.0M | |
| Everyday Chemical Reactions.pdf | 2022-03-16 13:19 | 943K | |
| Feeding Types.pdf | 2022-03-16 13:19 | 780K | |
| Food Chains.pdf | 2022-03-16 13:19 | 1.2M | |
| Food Webs.pdf | 2022-03-16 13:20 | 748K | |
| Formulae of Compounds.pdf | 2022-03-16 13:20 | 519K | |
| Fossil Fuels.pdf | 2022-03-16 13:20 | 1.4M | |
| Fighting Disease.pdf | 2022-03-16 13:21 | 1.2M | |
| Flooding.pdf | 2022-03-16 13:21 | 623K | |
| How is Electrical Energy Useful.pdf | 2022-03-16 13:27 | 629K | |