![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Alcohols.pdf | 2022-02-22 17:00 | 1.1M | |
| Atomic Number and Mass Number.pdf | 2022-02-22 17:00 | 811K | |
| Atomic Structure.pdf | 2022-02-22 17:00 | 460K | |
| Bonds and Activation Energy.pdf | 2022-02-22 17:01 | 1.2M | |
| Calorimetry.pdf | 2022-02-22 17:01 | 1.2M | |
| Carboxylic Acids.pdf | 2022-02-22 17:01 | 903K | |
| Chain Reactions.pdf | 2022-02-22 17:01 | 816K | |
| Changing State.pdf | 2022-02-22 17:01 | 734K | |
| Climate Change.pdf | 2022-02-22 17:02 | 660K | |
| Combustion.pdf | 2022-02-22 17:02 | 351K | |
| Comparing Bonding.pdf | 2022-02-22 17:02 | 1.0M | |
| Compound Ions.pdf | 2022-02-22 17:02 | 473K | |
| Compounds.pdf | 2022-02-22 17:03 | 277K | |
| Concentration Pressure and Reaction Rates.pdf | 2022-02-22 17:03 | 768K | |
| Conservation of Mass.pdf | 2022-02-22 17:03 | 483K | |
| Covalent Bonding.pdf | 2022-02-22 17:03 | 782K | |
| Dangers of Radiation.pdf | 2022-02-22 17:03 | 659K | |
| Dynamic Equilibrium.pdf | 2022-02-22 17:04 | 428K | |
| Earths Structure.pdf | 2022-02-22 17:04 | 406K | |
| Electrolysis of Dilute Sulfuric Acid.pdf | 2022-02-22 17:04 | 411K | |
| Electrolysis of Lead Bromide.pdf | 2022-02-22 17:04 | 921K | |
| Electrolysis of NaCl.pdf | 2022-02-22 17:05 | 849K | |
| Electron Configuration.pdf | 2022-02-22 17:05 | 623K | |
| Electron Structure and the Periodic Table.pdf | 2022-02-22 17:05 | 1.1M | |
| Electronegativity.pdf | 2022-02-22 17:05 | 577K | |
| Endothermic Reactions.pdf | 2022-02-22 17:06 | 1.1M | |
| Energy Sublevels.pdf | 2022-02-22 17:06 | 799K | |
| Energy Transfers.pdf | 2022-02-22 17:06 | 621K | |
| Enthalpy Change.pdf | 2022-02-22 17:06 | 1.4M | |
| Equilibrium - Changing Conditions.pdf | 2022-02-22 17:07 | 522K | |
| Esters.pdf | 2022-02-22 17:07 | 667K | |
| Exothermic Reactions.pdf | 2022-02-22 17:07 | 1.1M | |
| Extracting Aluminum.pdf | 2022-02-22 17:07 | 1.0M | |
| Fermentation.pdf | 2022-02-22 17:07 | 365K | |
| Formation of Ions.pdf | 2022-02-22 17:08 | 600K | |
| Functional Groups.pdf | 2022-02-22 17:08 | 461K | |
| Gamma Rays.pdf | 2022-02-22 17:08 | 531K | |
| Gas Chromatography.pdf | 2022-02-22 17:08 | 609K | |
| Gases and Moles.pdf | 2022-02-22 17:09 | 1.1M | |
| Giant Covalent Structures.pdf | 2022-02-22 17:09 | 1.6M | |
| Half-life.pdf | 2022-02-22 17:09 | 847K | |
| Heat.pdf | 2022-02-22 17:09 | 486K | |
| Hydrocarbons.pdf | 2022-02-22 17:10 | 518K | |
| Hydrogenation.pdf | 2022-02-22 17:10 | 868K | |
| Ideal Gas Laws.pdf | 2022-02-22 17:10 | 570K | |
| Intermolecular Forces.pdf | 2022-02-22 17:10 | 729K | |
| Introducing Atoms.pdf | 2022-02-22 17:10 | 597K | |
| Ionic Bonding.pdf | 2022-02-22 17:11 | 886K | |
| Ionic Compounds.pdf | 2022-02-22 17:11 | 1.0M | |
| Ionization Energy.pdf | 2022-02-22 17:11 | 806K | |
| Isomers.pdf | 2022-02-22 17:11 | 469K | |
| Isotopes.pdf | 2022-02-22 17:12 | 694K | |
| Le Chateliers Principle.pdf | 2022-02-22 17:12 | 1.5M | |
| Metallic Bonding.pdf | 2022-02-22 17:12 | 482K | |
| Molar Mass.pdf | 2022-02-22 17:12 | 256K | |
| Naming Compounds.pdf | 2022-02-22 17:13 | 452K | |
| Neutralization.pdf | 2022-02-22 17:13 | 766K | |
| Nuclear Fission.pdf | 2022-02-22 17:13 | 1.7M | |
| Nuclear Fusion.pdf | 2022-02-22 17:13 | 867K | |
| Nuclear Waste.pdf | 2022-02-22 17:13 | 689K | |
| Nucleic Acids.pdf | 2022-02-22 17:14 | 2.0M | |
| Observing Line Spectra.pdf | 2022-02-22 17:14 | 951K | |
| Orbitals.pdf | 2022-02-22 17:14 | 595K | |
| Oxidation Numbers.pdf | 2022-02-22 17:14 | 704K | |
| Particles in Action.pdf | 2022-02-22 17:15 | 1.4M | |
| Patterns of Behavior.pdf | 2022-02-22 17:15 | 476K | |
| Percentage Composition by Mass.pdf | 2022-02-22 17:15 | 629K | |
| pH and Indicators.pdf | 2022-02-22 17:15 | 878K | |
| Polymers.pdf | 2022-02-22 17:16 | 566K | |
| Polysaccharides.pdf | 2022-02-22 17:16 | 1.6M | |
| Properties of Acids and Alkalis.pdf | 2022-02-22 17:16 | 1.0M | |
| Proteins.pdf | 2022-02-22 17:16 | 1.7M | |
| Purification of Copper.pdf | 2022-02-22 17:17 | 589K | |
| Radioactive Dating.pdf | 2022-02-22 17:17 | 1.0M | |
| Radioactivity.pdf | 2022-02-22 17:17 | 771K | |
| Rates of Reaction.pdf | 2022-02-22 17:17 | 962K | |
| Reacting Masses.pdf | 2022-02-22 17:18 | 883K | |
| Redox Reactions.pdf | 2022-02-22 17:18 | 891K | |
| Relative Atomic Mass.pdf | 2022-02-22 17:18 | 725K | |
| Relative Formula Mass.pdf | 2022-02-22 17:18 | 565K | |
| Reversible Reactions.pdf | 2022-02-22 17:19 | 553K | |
| Separating Mixtures.pdf | 2022-02-22 17:19 | 1.2M | |
| Shapes of Molecules.pdf | 2022-02-22 17:19 | 298K | |
| Solubility.pdf | 2022-02-22 17:19 | 911K | |
| Solutions.pdf | 2022-02-22 17:19 | 1.1M | |
| Surface Area Catalysts and Reaction Rates.pdf | 2022-02-22 17:20 | 796K | |
| Temperature and Reaction Rates.pdf | 2022-02-22 17:20 | 653K | |
| The Atmosphere.pdf | 2022-02-22 17:20 | 700K | |
| The Haber Process.pdf | 2022-02-22 17:20 | 1.8M | |
| The Impact of Mining.pdf | 2022-02-22 17:21 | 446K | |
| The Impact of Using CFCs.pdf | 2022-02-22 17:21 | 1.2M | |
| The Noble Gases.pdf | 2022-02-22 17:21 | 398K | |
| The Periodic Table.pdf | 2022-02-22 17:21 | 1.3M | |
| The Photoelectric Effect.pdf | 2022-02-22 17:22 | 814K | |
| Thermal Decomposition.pdf | 2022-02-22 17:22 | 863K | |
| Types of Formulae.pdf | 2022-02-22 17:22 | 849K | |
| Types of Radiation.pdf | 2022-02-22 17:22 | 1.0M | |
| Uses of Radiation.pdf | 2022-02-22 17:23 | 1.2M | |
| Water.pdf | 2022-02-22 17:23 | 746K | |
| What are moles.pdf | 2022-02-22 17:23 | 1.4M | |
| Why do Atoms form Bonds.pdf | 2022-02-22 17:23 | 520K | |
| X-rays.pdf | 2022-02-22 17:23 | 753K | |
| Yield and Atom Economy.pdf | 2022-02-22 17:24 | 1.3M | |