![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Yield.pptx | 2019-01-31 12:29 | 861K | |
| Types of Chemical Bonds.pptx | 2019-01-31 12:29 | 2.5M | |
| Transition Metals.pptx | 2019-01-31 12:29 | 2.2M | |
| The Reactivity Series.pptx | 2019-01-31 12:29 | 2.4M | |
| The Haber Process.pptx | 2019-01-31 12:29 | 1.0M | |
| States of Matter.pptx | 2019-01-31 12:29 | 1.3M | |
| Solutions.pptx | 2019-01-31 12:29 | 939K | |
| Reversible Reactions and Equilibrium.pptx | 2019-01-31 12:29 | 1.6M | |
| Reacting Masses.pptx | 2019-01-31 12:29 | 1.2M | |
| Rate of Reaction.pptx | 2019-01-31 12:29 | 1.4M | |
| Properties of Metals and Alloys.pptx | 2019-01-31 12:29 | 3.1M | |
| Polymers.pptx | 2019-01-31 12:29 | 2.5M | |
| Particle Motion in Gases.pptx | 2019-01-31 12:29 | 2.0M | |
| Orbitals.pptx | 2019-01-31 12:29 | 1.3M | |
| Neutralization.pptx | 2019-01-31 12:29 | 2.0M | |
| Nanoparticles.pptx | 2019-01-31 12:29 | 1.3M | |
| Mixtures.pptx | 2019-01-31 12:29 | 2.1M | |
| Metals and Non Metals.pptx | 2019-01-31 12:29 | 2.5M | |
| Isotopes.pptx | 2019-01-31 12:29 | 1.2M | |
| Ionic Compounds.pptx | 2019-01-31 12:29 | 3.0M | |
| Ionic Bonding.pptx | 2019-01-31 12:28 | 2.8M | |
| Intermolecular Forces.pptx | 2019-01-31 12:28 | 764K | |
| Identifying Gases.pptx | 2019-01-31 12:28 | 879K | |
| Hydrocarbons.pptx | 2019-01-31 12:28 | 3.2M | |
| Group 7 Halogens.pptx | 2019-01-31 12:28 | 1.8M | |
| Group 1 Alkali Metals.pptx | 2019-01-31 12:28 | 2.9M | |
| Group 0 Noble Gases.pptx | 2019-01-31 12:28 | 1.5M | |
| Giant Covalent Structures.pptx | 2019-01-31 12:28 | 1.4M | |
| Gases and Moles.pptx | 2019-01-31 12:28 | 1.8M | |
| Fractional Distillation.pptx | 2019-01-31 12:28 | 5.2M | |
| Formulae and Equations.pptx | 2019-01-31 12:28 | 2.7M | |
| Flame Tests and Emission Spectroscopy.pptx | 2019-02-05 08:48 | 1.1M | |
| Extracting Metals.pptx | 2019-01-31 12:28 | 4.2M | |
| Exothermic and Endothermic Reactions.pptx | 2019-01-31 12:28 | 2.2M | |
| Enthalpy Change.pptx | 2019-01-31 12:28 | 698K | |
| Energy Changes in Reactions.pptx | 2019-01-31 12:28 | 1.0M | |
| Elements and The Periodic Table.pptx | 2019-01-31 12:28 | 2.3M | |
| Electronic Structure.pptx | 2019-01-31 12:28 | 1.1M | |
| Electronegativity.pptx | 2019-01-31 12:27 | 702K | |
| Electrolysis.pptx | 2019-01-31 12:27 | 1.9M | |
| Density and Changes of State.pptx | 2019-01-31 12:27 | 2.3M | |
| Cracking Hydrocarbons.pptx | 2019-01-31 12:27 | 2.8M | |
| Covalent Compounds.pptx | 2019-01-31 12:27 | 2.3M | |
| Covalent Bonding.pptx | 2019-01-31 12:27 | 2.2M | |
| Conservation of Mass.pptx | 2019-01-31 12:27 | 2.0M | |
| Concentration of Solutions.pptx | 2019-01-31 12:27 | 1.3M | |
| Chromatography.pptx | 2019-01-31 12:27 | 1.8M | |
| Changing Reaction Rates.pptx | 2019-01-31 12:27 | 1.2M | |
| Ceramics Polymers and Composites.pptx | 2019-01-31 12:27 | 2.1M | |
| Catalysts.pptx | 2019-01-31 12:27 | 741K | |
| Carboxylic Acids.pptx | 2019-01-31 12:27 | 2.2M | |
| Atoms and Subatomic Particles.pptx | 2019-01-31 12:27 | 2.2M | |
| Atomic Models.pptx | 2019-01-31 12:27 | 1.7M | |
| Atom Economy.pptx | 2019-01-31 12:27 | 1.1M | |
| Amount of Substance.pptx | 2019-01-31 12:27 | 1.4M | |
| Alkenes.pptx | 2019-01-31 12:27 | 893K | |
| Alkanes.pptx | 2019-01-31 12:27 | 2.5M | |
| Alcohols.pptx | 2019-01-31 12:27 | 2.2M | |
| Acids and Bases.pptx | 2019-01-31 12:27 | 2.7M | |
|
|---|