![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Acceleration.pdf | 2022-02-24 07:26 | 491K | |
| Calculating Resistance.pdf | 2022-02-24 07:26 | 441K | |
| Calorimetry.pdf | 2022-02-24 07:26 | 1.2M | |
| Changes in Momentum.pdf | 2022-02-24 07:26 | 384K | |
| Changing State.pdf | 2022-02-24 07:27 | 727K | |
| Circuit Diagrams.pdf | 2022-02-24 07:27 | 908K | |
| Circular Motion.pdf | 2022-02-24 07:27 | 774K | |
| Conduction and Convection.pdf | 2022-02-24 07:27 | 1.2M | |
| Conductors and Insulators.pdf | 2022-02-24 07:28 | 803K | |
| Conservation of Energy.pdf | 2022-02-24 07:28 | 848K | |
| Conservation of Momentum.pdf | 2022-02-24 07:28 | 1.2M | |
| Current and Potential Difference.pdf | 2022-02-24 07:28 | 786K | |
| Current Voltage and Resistance.pdf | 2022-02-24 07:28 | 1.4M | |
| Diffraction.pdf | 2022-02-24 07:28 | 674K | |
| Displacement Velocity and Acceleration.pdf | 2022-02-24 07:29 | 1.6M | |
| Doppler Effect.pdf | 2022-02-24 07:29 | 530K | |
| Electrical Power.pdf | 2022-02-24 07:29 | 346K | |
| Electromagnetic Waves.pdf | 2022-02-24 07:29 | 1.3M | |
| Energy Transfers.pdf | 2022-02-24 07:30 | 622K | |
| Factors Affecting Resistance1.pdf | 2022-02-24 07:30 | 682K | |
| Factors Affecting Resistance2.pdf | 2022-02-24 07:30 | 272K | |
| Fossil Fuels.pdf | 2022-02-24 07:30 | 964K | |
| Free-Body Diagrams.pdf | 2022-02-24 07:30 | 530K | |
| Friction.pdf | 2022-02-24 07:31 | 765K | |
| Gamma Rays.pdf | 2022-02-24 07:31 | 531K | |
| Gravitational Potential Energy.pdf | 2022-02-24 07:31 | 837K | |
| Gravity.pdf | 2022-02-24 07:31 | 460K | |
| Interference.pdf | 2022-02-24 07:31 | 1.1M | |
| Kinetic Energy.pdf | 2022-02-24 07:32 | 767K | |
| Lenses.pdf | 2022-02-24 07:32 | 1.6M | |
| Longitudinal Waves.pdf | 2022-02-24 07:32 | 635K | |
| Magnetism Current and Force.pdf | 2022-02-24 07:32 | 1.0M | |
| Mass and Weight.pdf | 2022-02-24 07:32 | 826K | |
| Momentum.pdf | 2022-02-24 07:33 | 387K | |
| Motors.pdf | 2022-02-24 07:33 | 763K | |
| Newtons First Law.pdf | 2022-02-24 07:33 | 557K | |
| Newtons Second Law.pdf | 2022-02-24 07:33 | 595K | |
| Newtons Third Law.pdf | 2022-02-24 07:33 | 564K | |
| Nuclear Fission.pdf | 2022-02-24 07:34 | 1.8M | |
| Nuclear Fusion.pdf | 2022-02-24 07:34 | 867K | |
| Observing Line Spectra.pdf | 2022-02-24 07:34 | 1.2M | |
| Particles in Action.pdf | 2022-02-24 07:34 | 1.4M | |
| Polarization.pdf | 2022-02-24 07:34 | 711K | |
| Power.pdf | 2022-02-24 07:35 | 813K | |
| Projectiles.pdf | 2022-02-24 07:35 | 1.2M | |
| Quarks and Antimatter.pdf | 2022-02-24 07:35 | 1.2M | |
| Radiation.pdf | 2022-02-24 07:35 | 1.2M | |
| Radioactive Dating.pdf | 2022-02-24 07:36 | 966K | |
| Radioactivity.pdf | 2022-02-24 07:36 | 769K | |
| Reflection.pdf | 2022-02-24 07:36 | 639K | |
| Refraction.pdf | 2022-02-24 07:36 | 1.1M | |
| Refractive Index.pdf | 2022-02-24 07:36 | 271K | |
| Series and Parallel Circuits.pdf | 2022-02-24 07:37 | 714K | |
| Sound.pdf | 2022-02-24 07:37 | 1.1M | |
| Speed and Velocity.pdf | 2022-02-24 07:37 | 520K | |
| Springs.pdf | 2022-02-24 07:37 | 1.5M | |
| Standing Waves.pdf | 2022-02-24 07:37 | 182K | |
| Static Electricity.pdf | 2022-02-24 07:38 | 1.2M | |
| Structure of the Atom.pdf | 2022-02-24 07:38 | 1.2M | |
| Superposition and Interference.pdf | 2022-02-24 07:38 | 895K | |
| The Big Bang Theory.pdf | 2022-02-24 07:38 | 380K | |
| The Life Cycle of Stars.pdf | 2022-02-24 07:39 | 1.1M | |
| The Photoelectric Effect.pdf | 2022-02-24 07:39 | 1.1M | |
| The Solar System.pdf | 2022-02-24 07:39 | 520K | |
| Transverse Waves.pdf | 2022-02-24 07:39 | 880K | |
| Types of Current.pdf | 2022-02-24 07:39 | 671K | |
| Types of Radiation.pdf | 2022-02-24 07:40 | 1.0M | |
| Uses of Radiation.pdf | 2022-02-24 07:40 | 1.2M | |
| Vectors and Scalars.pdf | 2022-02-24 07:40 | 535K | |
| Wave Properties of Particles.pdf | 2022-02-24 07:40 | 702K | |
| Waves.pdf | 2022-02-24 07:41 | 858K | |
| Work.pdf | 2022-02-24 07:41 | 945K | |
| X-rays.pdf | 2022-02-24 07:41 | 728K | |
|
|---|