![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Active Transport.pdf | 2022-02-22 16:32 | 671K | |
| Aerobic Respiration.pdf | 2022-02-22 16:32 | 426K | |
| Air Pollution.pdf | 2022-02-22 16:32 | 890K | |
| Alcohol Abuse.pdf | 2022-02-22 16:33 | 676K | |
| Anaerobic Respiration.pdf | 2022-02-22 16:33 | 540K | |
| Animal Adaptations.pdf | 2022-02-22 16:33 | 832K | |
| Antibodies and Vaccination.pdf | 2022-02-22 16:33 | 1.4M | |
| Asexual Reproduction.pdf | 2022-02-22 16:33 | 521K | |
| Behavior.pdf | 2022-02-22 16:34 | 1.1M | |
| Blood and Blood Vessels.pdf | 2022-02-22 16:34 | 1.4M | |
| Blood Transfusions.pdf | 2022-02-22 16:34 | 545K | |
| Body Temperature.pdf | 2022-02-22 16:34 | 424K | |
| Boy or Girl.pdf | 2022-02-22 16:35 | 627K | |
| Carbon Cycle.pdf | 2022-02-22 16:35 | 592K | |
| Cell Differentiation.pdf | 2022-02-22 16:35 | 650K | |
| Cell Theory.pdf | 2022-02-22 16:35 | 548K | |
| Cells to Organisms.pdf | 2022-02-22 16:35 | 846K | |
| Classification.pdf | 2022-02-22 16:36 | 2.1M | |
| Climate Change.pdf | 2022-02-22 16:36 | 659K | |
| Controlling Movement.pdf | 2022-02-22 16:36 | 639K | |
| Controlling Protein Synthesis.pdf | 2022-02-22 16:36 | 1.8M | |
| Darwin.pdf | 2022-02-22 16:37 | 778K | |
| Decomposers.pdf | 2022-02-22 16:37 | 840K | |
| Describing Populations.pdf | 2022-02-22 16:37 | 1.1M | |
| Development.pdf | 2022-02-22 16:37 | 570K | |
| Diabetes.pdf | 2022-02-22 16:38 | 783K | |
| Diffusion.pdf | 2022-02-22 16:38 | 1.1M | |
| Digestion.pdf | 2022-02-22 16:38 | 877K | |
| DNA Replication 1.pdf | 2022-02-22 16:38 | 905K | |
| DNA Replication 2.pdf | 2022-02-22 16:38 | 1.4M | |
| DNA.pdf | 2022-02-22 16:39 | 476K | |
| Ecosystems and Succession.pdf | 2022-02-22 16:39 | 1.4M | |
| Ecosystems.pdf | 2022-02-22 16:39 | 1.0M | |
| Electrocardiograms.pdf | 2022-02-22 16:39 | 633K | |
| Energy Loss in Food Chains.pdf | 2022-02-22 16:40 | 606K | |
| Energy Transfer in Food Chains.pdf | 2022-02-22 16:40 | 645K | |
| Environmental Variation.pdf | 2022-02-22 16:40 | 528K | |
| Enzyme Shape.pdf | 2022-02-22 16:40 | 775K | |
| Enzymes.pdf | 2022-02-22 16:40 | 538K | |
| Eukaryotic Cells.pdf | 2022-02-22 16:41 | 1.7M | |
| Evolution.pdf | 2022-02-22 16:41 | 709K | |
| Extinction.pdf | 2022-02-22 16:41 | 530K | |
| Female Reproductive System.pdf | 2022-02-22 16:41 | 1.0M | |
| Food Chains.pdf | 2022-02-22 16:42 | 1.1M | |
| Food Webs.pdf | 2022-02-22 16:42 | 664K | |
| Fossil Fuels.pdf | 2022-02-22 16:42 | 945K | |
| Fossil Record.pdf | 2022-02-22 16:42 | 877K | |
| Genes and Alleles.pdf | 2022-02-22 16:43 | 730K | |
| Genetic engineering for health care.pdf | 2022-02-22 16:43 | 937K | |
| Genetic Engineering.pdf | 2022-02-22 16:43 | 565K | |
| Genetic Mutations.pdf | 2022-02-22 16:43 | 1.0M | |
| Genetic Variation.pdf | 2022-02-22 16:43 | 401K | |
| Glucoregulation.pdf | 2022-02-22 16:44 | 848K | |
| GM organisms.pdf | 2022-02-22 16:44 | 748K | |
| Gregor Mendel.pdf | 2022-02-22 16:44 | 1.3M | |
| HIV and AIDS.pdf | 2022-02-22 16:44 | 1.6M | |
| Homeostasis.pdf | 2022-02-22 16:45 | 783K | |
| Hormones.pdf | 2022-02-22 16:45 | 458K | |
| Host-parasite relationships.pdf | 2022-02-22 16:45 | 397K | |
| Human Impact on the Environment.pdf | 2022-02-22 16:45 | 565K | |
| Human Populations.pdf | 2022-02-22 16:45 | 399K | |
| Immune Responses.pdf | 2022-02-22 16:46 | 1.4M | |
| Immune system.pdf | 2022-02-22 16:46 | 639K | |
| Incomplete Dominance and Codominance.pdf | 2022-02-22 16:46 | 587K | |
| Infectious Disease.pdf | 2022-02-22 16:46 | 557K | |
| Inherited Diseases.pdf | 2022-02-22 16:47 | 761K | |
| Introduction to Biodiversity.pdf | 2022-02-22 16:47 | 1.0M | |
| Lipids.pdf | 2022-02-22 16:47 | 1.4M | |
| Loss of Diversity.pdf | 2022-02-22 16:47 | 547K | |
| Meiosis.pdf | 2022-02-22 16:48 | 1.1M | |
| Microscopy.pdf | 2022-02-22 16:48 | 1.0M | |
| Mitosis.pdf | 2022-02-22 16:48 | 757K | |
| Monosaccharides.pdf | 2022-02-22 16:48 | 1.1M | |
| Nerve impulses.pdf | 2022-02-22 16:48 | 588K | |
| Nitrogen Cycle.pdf | 2022-02-22 16:49 | 933K | |
| Nucleic Acids.pdf | 2022-02-22 16:49 | 1.8M | |
| Nutrition.pdf | 2022-02-22 16:49 | 596K | |
| Organelles.pdf | 2022-02-22 16:50 | 788K | |
| Osmosis.pdf | 2022-02-22 16:50 | 1.1M | |
| Over-fishing.pdf | 2022-02-22 16:50 | 670K | |
| Pasteurization.pdf | 2022-02-22 16:50 | 437K | |
| Patterns of Inheritance.pdf | 2022-02-22 16:50 | 1.0M | |
| Photosynthesis1.pdf | 2022-02-22 16:51 | 497K | |
| Photosynthesis2.pdf | 2022-02-22 16:51 | 1.2M | |
| Plant Adaptations.pdf | 2022-02-22 16:51 | 498K | |
| Polysaccharides.pdf | 2022-02-22 16:51 | 1.5M | |
| Population Genetics.pdf | 2022-02-22 16:52 | 913K | |
| Predator-prey relationships.pdf | 2022-02-22 16:52 | 704K | |
| Prokaryotic Cells.pdf | 2022-02-22 16:52 | 1.0M | |
| Protein Synthesis.pdf | 2022-02-22 16:52 | 741K | |
| Proteins.pdf | 2022-02-22 16:53 | 1.7M | |
| Recycling Nutrients.pdf | 2022-02-22 16:53 | 600K | |
| Reflexes.pdf | 2022-02-22 16:53 | 624K | |
| Selective Breeding.pdf | 2022-02-22 16:53 | 370K | |
| Sliding Filament Theory.pdf | 2022-02-22 16:53 | 1.2M | |
| Smoking.pdf | 2022-02-22 16:54 | 911K | |
| Specialized Plant Cells.pdf | 2022-02-22 16:54 | 1.2M | |
| Superbugs.pdf | 2022-02-22 16:54 | 459K | |
| Sustainability.pdf | 2022-02-22 16:54 | 389K | |
| The Brain.pdf | 2022-02-22 16:55 | 320K | |
| The Endocrine System.pdf | 2022-02-22 16:55 | 668K | |
| The Fluid Mosaic Model.pdf | 2022-02-22 16:55 | 1.0M | |
| The Impact of Mining.pdf | 2022-02-22 16:55 | 446K | |
| The Impact of Using CFCs.pdf | 2022-02-22 16:55 | 1.2M | |
| The Kidneys.pdf | 2022-02-22 16:56 | 1.7M | |
| The Nervous System.pdf | 2022-02-22 16:56 | 519K | |
| The Process of Evolution.pdf | 2022-02-22 16:56 | 973K | |
| The Respiratory System.pdf | 2022-02-22 16:56 | 1.3M | |
| The Skeleton.pdf | 2022-02-22 16:57 | 1.2M | |
| The Stages of Meiosis.pdf | 2022-02-22 16:57 | 914K | |
| The Stages of Mitosis.pdf | 2022-02-22 16:57 | 1.0M | |
| Thermoregulation.pdf | 2022-02-22 16:57 | 1.5M | |
| Transcription and Translation.pdf | 2022-02-22 16:58 | 1.6M | |
| Tuberculosis.pdf | 2022-02-22 16:58 | 589K | |
| Types of Muscles.pdf | 2022-02-22 16:58 | 670K | |
| Understanding Genomes.pdf | 2022-02-22 16:58 | 612K | |
| Vaccinations.pdf | 2022-02-22 16:59 | 470K | |
| Ventilation.pdf | 2022-02-22 16:59 | 1.1M | |
| Water Cycle.pdf | 2022-02-22 16:59 | 460K | |
| Water pollution.pdf | 2022-02-22 16:59 | 416K | |
| Water.pdf | 2022-02-22 16:59 | 676K | |
| What is a Species.pdf | 2022-02-22 17:00 | 1.0M | |