![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | Earthquakes.pptx | 2019-01-31 12:22 | 6.2M | |
![[ ]](/icons/unknown.gif) | Climate Systems.pptx | 2019-01-31 12:22 | 6.0M | |
![[ ]](/icons/unknown.gif) | Weather.pptx | 2019-01-31 12:24 | 4.7M | |
![[ ]](/icons/unknown.gif) | Stars.pptx | 2019-01-31 12:23 | 4.7M | |
![[ ]](/icons/unknown.gif) | Natural Hazards.pptx | 2019-01-31 12:23 | 4.6M | |
![[ ]](/icons/unknown.gif) | Natural Resources.pptx | 2019-01-31 12:23 | 4.2M | |
![[ ]](/icons/unknown.gif) | Biogeology.pptx | 2019-01-31 12:22 | 4.1M | |
![[ ]](/icons/unknown.gif) | Earths Atmosphere.pptx | 2019-01-31 12:22 | 3.9M | |
![[ ]](/icons/unknown.gif) | Feedback Systems.pptx | 2019-01-31 12:23 | 3.7M | |
![[ ]](/icons/unknown.gif) | Water on Earth.pptx | 2019-01-31 12:24 | 3.5M | |
![[ ]](/icons/unknown.gif) | Fossils.pptx | 2019-01-31 12:23 | 3.5M | |
![[ ]](/icons/unknown.gif) | Carbon Footprints.pptx | 2019-01-31 12:22 | 3.5M | |
![[ ]](/icons/unknown.gif) | The Rock Cycle.pptx | 2019-01-31 12:23 | 3.4M | |
![[ ]](/icons/unknown.gif) | Origin of the Universe.pptx | 2019-01-31 12:23 | 3.1M | |
![[ ]](/icons/unknown.gif) | Pollution.pptx | 2019-01-31 12:23 | 2.7M | |
![[ ]](/icons/unknown.gif) | Weathering.pptx | 2019-01-31 12:24 | 2.7M | |
![[ ]](/icons/unknown.gif) | Climate Change.pptx | 2019-01-31 12:22 | 2.7M | |
![[ ]](/icons/unknown.gif) | Relief.pptx | 2019-01-31 12:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | The Greenhouse Effect.pptx | 2019-01-31 12:23 | 2.3M | |
![[ ]](/icons/unknown.gif) | CFCs and the Environment.pptx | 2019-01-31 12:22 | 2.3M | |
![[ ]](/icons/unknown.gif) | The Solar System.pptx | 2019-01-31 12:23 | 1.9M | |
![[ ]](/icons/unknown.gif) | ENSO.pptx | 2019-01-31 12:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | Sustainable Use of Resources.pptx | 2019-01-31 12:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | History of Earth.pptx | 2019-01-31 12:23 | 1.8M | |
![[ ]](/icons/unknown.gif) | Extracting Metals by Alternative Methods.pptx | 2019-01-31 12:23 | 1.7M | |
![[ ]](/icons/unknown.gif) | Understanding Earths Structure.pptx | 2019-01-31 12:23 | 1.5M | |
![[ ]](/icons/unknown.gif) | The Earth and Moon.pptx | 2019-01-31 12:23 | 1.4M | |
![[ ]](/icons/unknown.gif) | Seismic Waves.pptx | 2019-01-31 12:23 | 1.4M | |
![[ ]](/icons/unknown.gif) | Plate Tectonics.pptx | 2019-01-31 12:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | Astronomical Distances.pptx | 2019-01-31 12:22 | 1.2M | |
![[ ]](/icons/unknown.gif) | Solar Energy.pptx | 2019-01-31 12:23 | 1.2M | |
![[ ]](/icons/unknown.gif) | Volcanoes.pptx | 2019-01-31 12:23 | 1.1M | |
![[ ]](/icons/unknown.gif) | Satellites.pptx | 2019-01-31 12:23 | 742K | |
![[ ]](/icons/unknown.gif) | Telescopes.pptx | 2019-01-31 12:23 | 556K | |
|