![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Structure of the Atom.ppt | 2016-10-19 17:14 | 3.7M | |
| The Solar System.ppt | 2016-10-19 17:14 | 3.3M | |
| Observing Line Spectra.ppt | 2016-10-19 17:13 | 3.3M | |
| The Big Bang Theory.ppt | 2016-10-19 17:14 | 3.2M | |
| Displacement Velocity and Acceleration.ppt | 2016-10-19 17:12 | 3.2M | |
| Superposition and Interference.ppt | 2016-10-19 17:14 | 3.2M | |
| Springs.ppt | 2016-10-19 17:14 | 2.8M | |
| The Photoelectric Effect.ppt | 2016-10-19 17:14 | 2.7M | |
| Waves.ppt | 2016-10-19 17:15 | 2.6M | |
| The Life Cycle of Stars.ppt | 2016-10-19 17:14 | 2.3M | |
| Wave Properties of Particles.ppt | 2016-10-19 17:14 | 2.1M | |
| Free-Body Diagrams.ppt | 2016-10-19 17:12 | 2.1M | |
| Nuclear Fission.ppt | 2016-10-19 17:13 | 2.1M | |
| Circuit Diagrams.ppt | 2016-10-19 17:11 | 2.0M | |
| Electromagnetic Waves.ppt | 2016-10-19 17:12 | 1.9M | |
| Particles in Action.ppt | 2016-10-19 17:13 | 1.9M | |
| Lenses.ppt | 2016-10-19 17:12 | 1.9M | |
| Interference.ppt | 2016-10-19 17:12 | 1.9M | |
| Conservation of Energy.ppt | 2016-10-19 17:11 | 1.8M | |
| Static Electricity.ppt | 2016-10-19 17:14 | 1.8M | |
| Uses of Radiation.ppt | 2016-10-19 17:14 | 1.8M | |
| Conduction and Convection.ppt | 2016-10-19 17:11 | 1.8M | |
| Motors.ppt | 2016-10-19 17:12 | 1.7M | |
| Projectiles.ppt | 2016-10-19 17:13 | 1.6M | |
| Nuclear Fusion.ppt | 2016-10-19 17:13 | 1.6M | |
| X-rays.ppt | 2016-10-19 17:15 | 1.6M | |
| Quarks and Antimatter.ppt | 2016-10-19 17:13 | 1.6M | |
| Friction.ppt | 2016-10-19 17:12 | 1.6M | |
| Fossil Fuels.ppt | 2016-10-19 17:12 | 1.6M | |
| Kinetic Energy.ppt | 2016-10-19 17:12 | 1.5M | |
| Speed and Velocity.ppt | 2016-10-19 17:14 | 1.5M | |
| Circular Motion.ppt | 2016-10-19 17:11 | 1.5M | |
| Refraction.ppt | 2016-10-19 17:13 | 1.5M | |
| Current and Potential Difference.ppt | 2016-10-19 17:11 | 1.5M | |
| Newtons Second Law.ppt | 2016-10-19 17:13 | 1.4M | |
| Work.ppt | 2016-10-19 17:15 | 1.4M | |
| Power.ppt | 2016-10-19 17:13 | 1.4M | |
| Mass and Weight.ppt | 2016-10-19 17:12 | 1.4M | |
| Current Voltage and Resistance.ppt | 2016-10-19 17:11 | 1.3M | |
| Gravitational Potential Energy.ppt | 2016-10-19 17:12 | 1.3M | |
| Conservation of Momentum.ppt | 2016-10-19 17:11 | 1.3M | |
| Conductors and Insulators.ppt | 2016-10-19 17:11 | 1.3M | |
| Doppler Effect.ppt | 2016-10-19 17:12 | 1.3M | |
| Vectors and Scalars.ppt | 2016-10-19 17:14 | 1.3M | |
| Calorimetry.ppt | 2016-10-19 17:11 | 1.3M | |
| Radioactive Dating.ppt | 2016-10-19 17:13 | 1.3M | |
| Radiation.ppt | 2016-10-19 17:13 | 1.2M | |
| Sound.ppt | 2016-10-19 17:13 | 1.2M | |
| Types of Radiation.ppt | 2016-10-19 17:14 | 1.2M | |
| Energy Transfers.ppt | 2016-10-19 17:12 | 1.2M | |
| Factors Affecting Resistance1.ppt | 2016-10-19 17:12 | 1.2M | |
| Transverse Waves.ppt | 2016-10-19 17:14 | 1.1M | |
| Polarization.ppt | 2016-10-19 17:13 | 1.1M | |
| Reflection.ppt | 2016-10-19 17:13 | 1.1M | |
| Diffraction.ppt | 2016-10-19 17:11 | 1.1M | |
| Series and Parallel Circuits.ppt | 2016-10-19 17:13 | 1.1M | |
| Magnetism Current and Force.ppt | 2016-10-19 17:12 | 1.1M | |
| Newtons First Law.ppt | 2016-10-19 17:13 | 1.0M | |
| Acceleration.ppt | 2016-10-19 17:11 | 1.0M | |
| Changing State.ppt | 2016-10-19 17:11 | 1.0M | |
| Radioactivity.ppt | 2016-10-19 17:13 | 958K | |
| Newtons Third Law.ppt | 2016-10-19 17:13 | 954K | |
| Types of Current.ppt | 2016-10-19 17:14 | 915K | |
| Momentum.ppt | 2016-10-19 17:12 | 891K | |
| Changes in Momentum.ppt | 2016-10-19 17:11 | 886K | |
| Calculating Resistance.ppt | 2016-10-19 17:11 | 773K | |
| Gravity.ppt | 2016-10-19 17:12 | 767K | |
| Longitudinal Waves.ppt | 2016-10-19 17:12 | 718K | |
| Gamma Rays.ppt | 2016-10-19 17:12 | 678K | |
| Electrical Power.ppt | 2016-10-19 17:12 | 639K | |
| Factors Affecting Resistance2.ppt | 2016-10-19 17:12 | 589K | |
| Refractive Index.ppt | 2016-10-19 17:13 | 463K | |
| Standing Waves.ppt | 2016-10-19 17:14 | 348K | |
| HS Physics Worksheets/ | 2023-12-08 09:19 | - | |