![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| pH and Indicators.ppt | 2016-10-19 17:36 | 1.3M | |
| Yield and Atom Economy.ppt | 2016-10-19 17:38 | 1.6M | |
| X-rays.ppt | 2016-10-19 17:38 | 1.7M | |
| Why do Atoms form Bonds.ppt | 2016-10-19 17:38 | 670K | |
| What are moles.ppt | 2016-10-19 17:38 | 1.5M | |
| Water.ppt | 2016-10-19 17:38 | 877K | |
| Uses of Radiation.ppt | 2016-10-19 17:38 | 1.8M | |
| Types of Radiation.ppt | 2016-10-19 17:38 | 1.2M | |
| Types of Formulae.ppt | 2016-10-19 17:38 | 1.0M | |
| Thermal Decomposition.ppt | 2016-10-19 17:38 | 1.2M | |
| The Photoelectric Effect.ppt | 2016-10-19 17:37 | 2.5M | |
| The Periodic Table.ppt | 2016-10-19 17:37 | 2.0M | |
| The Noble Gases.ppt | 2016-10-19 17:37 | 652K | |
| The Impact of Using CFCs.ppt | 2016-10-19 17:37 | 1.7M | |
| The Impact of Mining.ppt | 2016-10-19 17:37 | 768K | |
| The Haber Process.ppt | 2016-10-19 17:37 | 2.4M | |
| The Atmosphere.ppt | 2016-10-19 17:37 | 871K | |
| Temperature and Reaction Rates.ppt | 2016-10-19 17:37 | 935K | |
| Surface Area Catalysts and Reaction Rates.ppt | 2016-10-19 17:37 | 937K | |
| Solutions.ppt | 2016-10-19 17:37 | 1.4M | |
| Solubility.ppt | 2016-10-19 17:37 | 1.3M | |
| Shapes of Molecules.ppt | 2016-10-19 17:37 | 562K | |
| Separating Mixtures.ppt | 2016-10-19 17:37 | 1.5M | |
| Reversible Reactions.ppt | 2016-10-19 17:37 | 892K | |
| Relative Formula Mass.ppt | 2016-10-19 17:37 | 790K | |
| Relative Atomic Mass.ppt | 2016-10-19 17:37 | 888K | |
| Redox Reactions.ppt | 2016-10-19 17:37 | 1.6M | |
| Reacting Masses.ppt | 2016-10-19 17:37 | 1.4M | |
| Rates of Reaction.ppt | 2016-10-19 17:37 | 1.2M | |
| Radioactivity.ppt | 2016-10-19 17:37 | 959K | |
| Radioactive Dating.ppt | 2016-10-19 17:37 | 1.3M | |
| Purification of Copper.ppt | 2016-10-19 17:37 | 852K | |
| Proteins.ppt | 2016-10-19 17:37 | 1.8M | |
| Properties of Acids and Alkalis.ppt | 2016-10-19 17:36 | 1.4M | |
| Polysaccharides.ppt | 2016-10-19 17:36 | 1.5M | |
| Polymers.ppt | 2016-10-19 17:36 | 968K | |
| Percentage Composition by Mass.ppt | 2016-10-19 17:36 | 1.2M | |
| Patterns of Behavior.ppt | 2016-10-19 17:36 | 1.0M | |
| Particles in Action.ppt | 2016-10-19 17:36 | 1.9M | |
| Oxidation Numbers.ppt | 2016-10-19 17:36 | 855K | |
| Orbitals.ppt | 2016-10-19 17:36 | 1.6M | |
| Observing Line Spectra.ppt | 2016-10-19 17:36 | 2.9M | |
| Nucleic Acids.ppt | 2016-10-19 17:36 | 1.8M | |
| Nuclear Waste.ppt | 2016-10-19 17:36 | 1.0M | |
| Nuclear Fusion.ppt | 2016-10-19 17:36 | 1.6M | |
| Nuclear Fission.ppt | 2016-10-19 17:36 | 2.0M | |
| Neutralization.ppt | 2016-10-19 17:36 | 1.3M | |
| Naming Compounds.ppt | 2016-10-19 17:36 | 1.2M | |
| Molar Mass.ppt | 2016-10-19 17:36 | 497K | |
| Metallic Bonding.ppt | 2016-10-19 17:36 | 1.2M | |
| Le Chateliers Principle.ppt | 2016-10-19 17:36 | 1.4M | |
| Isotopes.ppt | 2016-10-19 17:36 | 1.1M | |
| Isomers.ppt | 2016-10-19 17:36 | 607K | |
| Ionization Energy.ppt | 2016-10-19 17:36 | 966K | |
| Ionic Compounds.ppt | 2016-10-19 17:36 | 1.5M | |
| Ionic Bonding.ppt | 2016-10-19 17:36 | 1.4M | |
| Introducing Atoms.ppt | 2016-10-19 17:35 | 1.5M | |
| Intermolecular Forces.ppt | 2016-10-19 17:35 | 1.3M | |
| Ideal Gas Laws.ppt | 2016-10-19 17:35 | 930K | |
| Hydrogenation.ppt | 2016-10-19 17:35 | 1.7M | |
| Hydrocarbons.ppt | 2016-10-19 17:35 | 707K | |
| Heat.ppt | 2016-10-19 17:35 | 694K | |
| Half-life.ppt | 2016-10-19 17:35 | 833K | |
| Giant Covalent Structures.ppt | 2016-10-19 17:35 | 2.1M | |
| Gases and Moles.ppt | 2016-10-19 17:35 | 1.8M | |
| Gas Chromatography.ppt | 2016-10-19 17:35 | 1.0M | |
| Gamma Rays.ppt | 2016-10-19 17:35 | 672K | |
| Functional Groups.ppt | 2016-10-19 17:35 | 679K | |
| Formation of Ions.ppt | 2016-10-19 17:35 | 1.3M | |
| Fermentation.ppt | 2016-10-19 17:35 | 666K | |
| Extracting Aluminum.ppt | 2016-10-19 17:35 | 1.2M | |
| Exothermic Reactions.ppt | 2016-10-19 17:35 | 1.2M | |
| Esters.ppt | 2016-10-19 17:35 | 1.0M | |
| Equilibrium - Changing Conditions.ppt | 2016-10-19 17:35 | 739K | |
| Enthalpy Change.ppt | 2016-10-19 17:35 | 1.5M | |
| Energy Transfers.ppt | 2016-10-19 17:35 | 1.2M | |
| Energy Sublevels.ppt | 2016-10-19 17:35 | 1.0M | |
| Endothermic Reactions.ppt | 2016-10-19 17:35 | 1.3M | |
| Electronegativity.ppt | 2016-10-19 17:35 | 1.0M | |
| Electron Structure and the Periodic Table.ppt | 2016-10-19 17:35 | 1.8M | |
| Electron Configuration.ppt | 2016-10-19 17:35 | 1.1M | |
| Electrolysis of NaCl.ppt | 2016-10-19 17:34 | 940K | |
| Electrolysis of Lead Bromide.ppt | 2016-10-19 17:34 | 945K | |
| Electrolysis of Dilute Sulfuric Acid.ppt | 2016-10-19 17:34 | 490K | |
| Earths Structure.ppt | 2016-10-19 17:34 | 968K | |
| Dynamic Equilibrium.ppt | 2016-10-19 17:34 | 709K | |
| Dangers of Radiation.ppt | 2016-10-19 17:34 | 2.5M | |
| Covalent Bonding.ppt | 2016-10-19 17:34 | 1.2M | |
| Conservation of Mass.ppt | 2016-10-19 17:34 | 580K | |
| Concentration Pressure and Reaction Rates.ppt | 2016-10-19 17:34 | 795K | |
| Compounds.ppt | 2016-10-19 17:34 | 565K | |
| Compound Ions.ppt | 2016-10-19 17:34 | 1.3M | |
| Comparing Bonding.ppt | 2016-10-19 17:34 | 2.3M | |
| Combustion.ppt | 2016-10-19 17:34 | 752K | |
| Climate Change.ppt | 2016-10-19 17:34 | 1.7M | |
| Changing State.ppt | 2016-10-19 17:34 | 1.0M | |
| Chain Reactions.ppt | 2016-10-19 17:34 | 1.6M | |
| Carboxylic Acids.ppt | 2016-10-19 17:34 | 1.4M | |
| Calorimetry.ppt | 2016-10-19 17:34 | 1.3M | |
| Bonds and Activation Energy.ppt | 2016-10-19 17:34 | 1.4M | |
| Atomic Structure.ppt | 2016-10-19 17:34 | 1.0M | |
| Atomic Number and Mass Number.ppt | 2016-10-19 17:34 | 1.1M | |
| Alcohols.ppt | 2016-10-19 17:34 | 1.4M | |